C25H25ClN2O4S — CID 142625442
2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid (PubChem CID 142625442) has the molecular formula C25H25ClN2O4S and a molecular weight of 485.01 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
|---|---|
| PubChem CID | 142625442 |
| Molecular Formula | C25H25ClN2O4S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| SMILES | O=C(O)C(CCC=Cc1cccnc1)c1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H25ClN2O4S/c26-22-11-13-23(14-12-22)33(31,32)28-17-15-19-7-9-21(10-8-19)24(25(29)30)6-2-1-4-20-5-3-16-27-18-20/h1,3-5,7-14,16,18,24,28H,2,6,15,17H2,(H,29,30) |
| InChIKey | WRZHIORQGURVSY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |