C18H20ClNO5S — CID 70371933
2-[4-[2-[(3-chlorophenyl)sulfonylamino]ethyl]phenyl]-4-hydroxybutanoic acid (PubChem CID 70371933) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-[4-[2-[(3-chlorophenyl)sulfonylamino]ethyl]phenyl]-4-hydroxybutanoic acid.
| Compound Name | 2-[4-[2-[(3-chlorophenyl)sulfonylamino]ethyl]phenyl]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 70371933 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-[4-[2-[(3-chlorophenyl)sulfonylamino]ethyl]phenyl]-4-hydroxybutanoic acid |
| SMILES | O=C(O)C(CCO)c1ccc(CCNS(=O)(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20ClNO5S/c19-15-2-1-3-16(12-15)26(24,25)20-10-8-13-4-6-14(7-5-13)17(9-11-21)18(22)23/h1-7,12,17,20-21H,8-11H2,(H,22,23) |
| InChIKey | XSRYLQIPYCSEHA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |