C20H25ClN2O2S — CID 16890345
N-[2-[4-(azepan-1-yl)phenyl]ethyl]-3-chlorobenzenesulfonamide (PubChem CID 16890345) has the molecular formula C20H25ClN2O2S and a molecular weight of 392.95 g/mol. Its IUPAC name is N-[2-[4-(azepan-1-yl)phenyl]ethyl]-3-chlorobenzenesulfonamide.
| Compound Name | N-[2-[4-(azepan-1-yl)phenyl]ethyl]-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 16890345 |
| Molecular Formula | C20H25ClN2O2S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[2-[4-(azepan-1-yl)phenyl]ethyl]-3-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(N2CCCCCC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H25ClN2O2S/c21-18-6-5-7-20(16-18)26(24,25)22-13-12-17-8-10-19(11-9-17)23-14-3-1-2-4-15-23/h5-11,16,22H,1-4,12-15H2 |
| InChIKey | BKWQAFOUUWAKCZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|