C21H28N2O3S — CID 16890547
4-methoxy-3,5-dimethyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]benzenesulfonamide (PubChem CID 16890547) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-3,5-dimethyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16890547 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1c(C)cc(S(=O)(=O)NCCc2ccc(N3CCCC3)cc2)cc1C |
| InChI | InChI=1S/C21H28N2O3S/c1-16-14-20(15-17(2)21(16)26-3)27(24,25)22-11-10-18-6-8-19(9-7-18)23-12-4-5-13-23/h6-9,14-15,22H,4-5,10-13H2,1-3H3 |
| InChIKey | ZFLDQWWWHZHMEX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|