C18H19NO6S — CID 88613886
2-[4-[2-[(4-hydroxyphenyl)sulfonylamino]ethyl]phenyl]-4-oxobutanoic acid (PubChem CID 88613886) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[4-[2-[(4-hydroxyphenyl)sulfonylamino]ethyl]phenyl]-4-oxobutanoic acid.
| Compound Name | 2-[4-[2-[(4-hydroxyphenyl)sulfonylamino]ethyl]phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88613886 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[4-[2-[(4-hydroxyphenyl)sulfonylamino]ethyl]phenyl]-4-oxobutanoic acid |
| SMILES | O=CCC(C(=O)O)c1ccc(CCNS(=O)(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H19NO6S/c20-12-10-17(18(22)23)14-3-1-13(2-4-14)9-11-19-26(24,25)16-7-5-15(21)6-8-16/h1-8,12,17,19,21H,9-11H2,(H,22,23) |
| InChIKey | STXGOQKSOJCSOQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|