C11H13N3O3S — CID 54903977
N-[2-(4-hydroxyphenyl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 54903977) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54903977 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccc(O)cc1)c1cn[nH]c1 |
| InChI | InChI=1S/C11H13N3O3S/c15-10-3-1-9(2-4-10)5-6-14-18(16,17)11-7-12-13-8-11/h1-4,7-8,14-15H,5-6H2,(H,12,13) |
| InChIKey | IQNFWPUVSVFENA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |