C9H11N3O2S2 — CID 47372092
N-(2-thiophen-3-ylethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 47372092) has the molecular formula C9H11N3O2S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-(2-thiophen-3-ylethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-thiophen-3-ylethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47372092 |
| Molecular Formula | C9H11N3O2S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | N-(2-thiophen-3-ylethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccsc1)c1cn[nH]c1 |
| InChI | InChI=1S/C9H11N3O2S2/c13-16(14,9-5-10-11-6-9)12-3-1-8-2-4-15-7-8/h2,4-7,12H,1,3H2,(H,10,11) |
| InChIKey | DQEKMGQIMZYNHC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |