C8H10N4O2S2 — CID 49460068
N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 49460068) has the molecular formula C8H10N4O2S2 and a molecular weight of 258.33 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 49460068 |
| Molecular Formula | C8H10N4O2S2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | N-[2-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCc1nccs1)c1cn[nH]c1 |
| InChI | InChI=1S/C8H10N4O2S2/c13-16(14,7-5-10-11-6-7)12-2-1-8-9-3-4-15-8/h3-6,12H,1-2H2,(H,10,11) |
| InChIKey | FQJFGUWKPWBVAM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |