C10H11N3O4S2 — CID 61473154
5-(2-thiophen-3-ylethylsulfamoyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 61473154) has the molecular formula C10H11N3O4S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-(2-thiophen-3-ylethylsulfamoyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(2-thiophen-3-ylethylsulfamoyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61473154 |
| Molecular Formula | C10H11N3O4S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-(2-thiophen-3-ylethylsulfamoyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)NCCc1ccsc1 |
| InChI | InChI=1S/C10H11N3O4S2/c14-10(15)8-5-11-13-9(8)19(16,17)12-3-1-7-2-4-18-6-7/h2,4-6,12H,1,3H2,(H,11,13)(H,14,15) |
| InChIKey | QHUKXEWUGAPDTL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |