C23H24ClN3O4S — CID 139687172
methyl (E)-3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-methyl-4-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoate (PubChem CID 139687172) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is methyl (E)-3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-methyl-4-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-methyl-4-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139687172 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | methyl (E)-3-[5-[2-[(4-chlorophenyl)sulfonylamino]ethyl]-1-methyl-4-(pyridin-3-ylmethyl)pyrrol-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(Cc2cccnc2)c(CCNS(=O)(=O)c2ccc(Cl)cc2)n1C |
| InChI | InChI=1S/C23H24ClN3O4S/c1-27-20(7-10-23(28)31-2)15-18(14-17-4-3-12-25-16-17)22(27)11-13-26-32(29,30)21-8-5-19(24)6-9-21/h3-10,12,15-16,26H,11,13-14H2,1-2H3/b10-7+ |
| InChIKey | VCKBVONBITYBMT-JXMROGBWSA-N |
| XLogP | 3.37 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|