C18H18ClN3O2S — CID 139709183
4-chloro-N-[2-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]ethyl]benzenesulfonamide (PubChem CID 139709183) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 4-chloro-N-[2-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139709183 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-chloro-N-[2-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cccn1Cc1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c19-16-5-7-18(8-6-16)25(23,24)21-11-9-17-4-2-12-22(17)14-15-3-1-10-20-13-15/h1-8,10,12-13,21H,9,11,14H2 |
| InChIKey | KBWQZJREKQXTED-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |