C19H19ClN2O2S — CID 53000346
4-chloro-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzenesulfonamide (PubChem CID 53000346) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is 4-chloro-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 53000346 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-chloro-N-[[1-[(4-methylphenyl)methyl]pyrrol-2-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(Cn2cccc2CNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H19ClN2O2S/c1-15-4-6-16(7-5-15)14-22-12-2-3-18(22)13-21-25(23,24)19-10-8-17(20)9-11-19/h2-12,21H,13-14H2,1H3 |
| InChIKey | XAIGYNGGGFAUIO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |