C23H28N2O2S — CID 20963939
N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(2-methylpropyl)benzenesulfonamide (PubChem CID 20963939) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20963939 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]-4-(2-methylpropyl)benzenesulfonamide |
| SMILES | Cc1ccccc1Cn1cccc1CNS(=O)(=O)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O2S/c1-18(2)15-20-10-12-23(13-11-20)28(26,27)24-16-22-9-6-14-25(22)17-21-8-5-4-7-19(21)3/h4-14,18,24H,15-17H2,1-3H3 |
| InChIKey | XRXIEWCGTVHNBT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |