C18H15Cl2FN2O2S — CID 20963907
3-chloro-N-[[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-fluorobenzenesulfonamide (PubChem CID 20963907) has the molecular formula C18H15Cl2FN2O2S and a molecular weight of 413.30 g/mol. Its IUPAC name is 3-chloro-N-[[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-fluorobenzenesulfonamide.
| Compound Name | 3-chloro-N-[[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 20963907 |
| Molecular Formula | C18H15Cl2FN2O2S |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 3-chloro-N-[[1-[(4-chlorophenyl)methyl]pyrrol-2-yl]methyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cccn1Cc1ccc(Cl)cc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2FN2O2S/c19-14-5-3-13(4-6-14)12-23-9-1-2-15(23)11-22-26(24,25)16-7-8-18(21)17(20)10-16/h1-10,22H,11-12H2 |
| InChIKey | ORTMCTGQZMBPKC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |