C20H26Cl2N2O4S — CID 45262201
9-[(4-chlorophenyl)sulfonylamino]-8-pyridin-3-ylnonanoic acid;hydrochloride (PubChem CID 45262201) has the molecular formula C20H26Cl2N2O4S and a molecular weight of 461.41 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)sulfonylamino]-8-pyridin-3-ylnonanoic acid;hydrochloride.
| Compound Name | 9-[(4-chlorophenyl)sulfonylamino]-8-pyridin-3-ylnonanoic acid;hydrochloride |
|---|---|
| PubChem CID | 45262201 |
| Molecular Formula | C20H26Cl2N2O4S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 9-[(4-chlorophenyl)sulfonylamino]-8-pyridin-3-ylnonanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCCCC(CNS(=O)(=O)c1ccc(Cl)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H25ClN2O4S.ClH/c21-18-9-11-19(12-10-18)28(26,27)23-15-17(16-7-5-13-22-14-16)6-3-1-2-4-8-20(24)25;/h5,7,9-14,17,23H,1-4,6,8,15H2,(H,24,25);1H |
| InChIKey | KANLYGHVMAEXCB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|