C25H27FN2O4S — CID 19874797
8-[(4-fluorophenyl)sulfonylamino]-4-(4-pyridin-3-ylphenyl)octanoic acid (PubChem CID 19874797) has the molecular formula C25H27FN2O4S and a molecular weight of 470.57 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)sulfonylamino]-4-(4-pyridin-3-ylphenyl)octanoic acid.
| Compound Name | 8-[(4-fluorophenyl)sulfonylamino]-4-(4-pyridin-3-ylphenyl)octanoic acid |
|---|---|
| PubChem CID | 19874797 |
| Molecular Formula | C25H27FN2O4S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 8-[(4-fluorophenyl)sulfonylamino]-4-(4-pyridin-3-ylphenyl)octanoic acid |
| SMILES | O=C(O)CCC(CCCCNS(=O)(=O)c1ccc(F)cc1)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C25H27FN2O4S/c26-23-11-13-24(14-12-23)33(31,32)28-17-2-1-4-19(10-15-25(29)30)20-6-8-21(9-7-20)22-5-3-16-27-18-22/h3,5-9,11-14,16,18-19,28H,1-2,4,10,15,17H2,(H,29,30) |
| InChIKey | ORXBTUQYCWGTEW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|