C14H14N2O4S — CID 110454171
3-[(4-pyridin-4-ylphenyl)sulfonylamino]propanoic acid (PubChem CID 110454171) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 3-[(4-pyridin-4-ylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(4-pyridin-4-ylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 110454171 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-[(4-pyridin-4-ylphenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C14H14N2O4S/c17-14(18)7-10-16-21(19,20)13-3-1-11(2-4-13)12-5-8-15-9-6-12/h1-6,8-9,16H,7,10H2,(H,17,18) |
| InChIKey | DRMNUMVUOKEGJI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |