C19H18N2O9S2 — CID 2146033
3-[[7-(2-carboxyethylsulfamoyl)-9-oxofluoren-2-yl]sulfonylamino]propanoic acid (PubChem CID 2146033) has the molecular formula C19H18N2O9S2 and a molecular weight of 482.49 g/mol. Its IUPAC name is 3-[[7-(2-carboxyethylsulfamoyl)-9-oxofluoren-2-yl]sulfonylamino]propanoic acid.
| Compound Name | 3-[[7-(2-carboxyethylsulfamoyl)-9-oxofluoren-2-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 2146033 |
| Molecular Formula | C19H18N2O9S2 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 3-[[7-(2-carboxyethylsulfamoyl)-9-oxofluoren-2-yl]sulfonylamino]propanoic acid |
| SMILES | O=C(O)CCNS(=O)(=O)c1ccc2c(c1)C(=O)c1cc(S(=O)(=O)NCCC(=O)O)ccc1-2 |
| InChI | InChI=1S/C19H18N2O9S2/c22-17(23)5-7-20-31(27,28)11-1-3-13-14-4-2-12(10-16(14)19(26)15(13)9-11)32(29,30)21-8-6-18(24)25/h1-4,9-10,20-21H,5-8H2,(H,22,23)(H,24,25) |
| InChIKey | WKFCSARRFIRMDV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 184.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |