C27H18N2O7S2 — CID 2294379
N-[7-(benzoylsulfamoyl)-9-oxofluoren-2-yl]sulfonylbenzamide (PubChem CID 2294379) has the molecular formula C27H18N2O7S2 and a molecular weight of 546.58 g/mol. Its IUPAC name is N-[7-(benzoylsulfamoyl)-9-oxofluoren-2-yl]sulfonylbenzamide.
| Compound Name | N-[7-(benzoylsulfamoyl)-9-oxofluoren-2-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 2294379 |
| Molecular Formula | C27H18N2O7S2 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | N-[7-(benzoylsulfamoyl)-9-oxofluoren-2-yl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc2c(c1)C(=O)c1cc(S(=O)(=O)NC(=O)c3ccccc3)ccc1-2)c1ccccc1 |
| InChI | InChI=1S/C27H18N2O7S2/c30-25-23-15-19(37(33,34)28-26(31)17-7-3-1-4-8-17)11-13-21(23)22-14-12-20(16-24(22)25)38(35,36)29-27(32)18-9-5-2-6-10-18/h1-16H,(H,28,31)(H,29,32) |
| InChIKey | GFJNQWKAHKQNBW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |