C23H15ClN2O5S — CID 90845231
N-[4-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]phenyl]sulfonylbenzamide (PubChem CID 90845231) has the molecular formula C23H15ClN2O5S and a molecular weight of 466.90 g/mol. Its IUPAC name is N-[4-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]phenyl]sulfonylbenzamide.
| Compound Name | N-[4-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 90845231 |
| Molecular Formula | C23H15ClN2O5S |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | N-[4-[(3-chloro-1,4-dioxonaphthalen-2-ylidene)amino]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(/N=C2/C(=O)c3ccccc3C(=O)C2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H15ClN2O5S/c24-19-20(22(28)18-9-5-4-8-17(18)21(19)27)25-15-10-12-16(13-11-15)32(30,31)26-23(29)14-6-2-1-3-7-14/h1-13,19H,(H,26,29)/b25-20+ |
| InChIKey | LRMOONCZGCNJCB-LKUDQCMESA-N |
| XLogP | 3.56 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|