C22H19N3O5S — CID 123769723
N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide (PubChem CID 123769723) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 123769723 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(/N=C3/C(=O)c4ccccc4C(=O)C3C)cc2)c1C |
| InChI | InChI=1S/C22H19N3O5S/c1-12-14(3)24-30-22(12)25-31(28,29)16-10-8-15(9-11-16)23-19-13(2)20(26)17-6-4-5-7-18(17)21(19)27/h4-11,13,25H,1-3H3/b23-19+ |
| InChIKey | NPFLDRMKLZZBHH-FCDQGJHFSA-N |
| XLogP | 3.88 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|