C22H19N3O4S — CID 135921045
N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzenesulfonamide (PubChem CID 135921045) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135921045 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(/N=C/c3c(O)ccc4ccccc34)cc2)c1C |
| InChI | InChI=1S/C22H19N3O4S/c1-14-15(2)24-29-22(14)25-30(27,28)18-10-8-17(9-11-18)23-13-20-19-6-4-3-5-16(19)7-12-21(20)26/h3-13,25-26H,1-2H3/b23-13+ |
| InChIKey | DIPFYNMWLXTQDM-YDZHTSKRSA-N |
| XLogP | 4.70 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|