C20H23N5O5S2 — CID 135689474
4-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 135689474) has the molecular formula C20H23N5O5S2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 4-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | 4-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135689474 |
| Molecular Formula | C20H23N5O5S2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-[(1,3-diethyl-4-hydroxy-6-oxo-2-sulfanylidenepyrimidin-5-yl)methylideneamino]-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | CCn1c(O)c(/C=N/c2ccc(S(=O)(=O)Nc3onc(C)c3C)cc2)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C20H23N5O5S2/c1-5-24-18(26)16(19(27)25(6-2)20(24)31)11-21-14-7-9-15(10-8-14)32(28,29)23-17-12(3)13(4)22-30-17/h7-11,23,26H,5-6H2,1-4H3/b21-11+ |
| InChIKey | UZSNUIVZKWAFPL-SRZZPIQSSA-N |
| XLogP | 3.28 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|