C11H12N2O4S — CID 10015852
N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydroxybenzenesulfonamide (PubChem CID 10015852) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydroxybenzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 10015852 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydroxybenzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(O)cc2)c1C |
| InChI | InChI=1S/C11H12N2O4S/c1-7-8(2)12-17-11(7)13-18(15,16)10-5-3-9(14)4-6-10/h3-6,13-14H,1-2H3 |
| InChIKey | WXHUJRKRFANUNH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |