C26H37N7O8S2 — CID 66830855
bis(4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide);2-(2-hydroxyethylamino)ethanol (PubChem CID 66830855) has the molecular formula C26H37N7O8S2 and a molecular weight of 639.76 g/mol. Its IUPAC name is bis(4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide);2-(2-hydroxyethylamino)ethanol.
| Compound Name | bis(4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide);2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 66830855 |
| Molecular Formula | C26H37N7O8S2 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | bis(4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide);2-(2-hydroxyethylamino)ethanol |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C.Cc1noc(NS(=O)(=O)c2ccc(N)cc2)c1C.OCCNCCO |
| InChI | InChI=1S/2C11H13N3O3S.C4H11NO2/c2*1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10;6-3-1-5-2-4-7/h2*3-6,14H,12H2,1-2H3;5-7H,1-4H2 |
| InChIKey | KWVTXHIHNQVVFI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 248.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|