C22H18N4O5S — CID 91447062
N-(5-methoxypyrimidin-2-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide (PubChem CID 91447062) has the molecular formula C22H18N4O5S and a molecular weight of 450.48 g/mol. Its IUPAC name is N-(5-methoxypyrimidin-2-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide.
| Compound Name | N-(5-methoxypyrimidin-2-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 91447062 |
| Molecular Formula | C22H18N4O5S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-(5-methoxypyrimidin-2-yl)-4-[(3-methyl-1,4-dioxonaphthalen-2-ylidene)amino]benzenesulfonamide |
| SMILES | COc1cnc(NS(=O)(=O)c2ccc(/N=C3/C(=O)c4ccccc4C(=O)C3C)cc2)nc1 |
| InChI | InChI=1S/C22H18N4O5S/c1-13-19(21(28)18-6-4-3-5-17(18)20(13)27)25-14-7-9-16(10-8-14)32(29,30)26-22-23-11-15(31-2)12-24-22/h3-13H,1-2H3,(H,23,24,26)/b25-19+ |
| InChIKey | UFDSZVVGRXMZHA-NCELDCMTSA-N |
| XLogP | 3.07 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|