C17H20N4O8S — CID 10094770
4-[[(2S,3R)-2,4-dihydroxy-3-[(1S)-1-hydroxy-2-oxoethoxy]butylidene]amino]-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide (PubChem CID 10094770) has the molecular formula C17H20N4O8S and a molecular weight of 440.43 g/mol. Its IUPAC name is 4-[[(2S,3R)-2,4-dihydroxy-3-[(1S)-1-hydroxy-2-oxoethoxy]butylidene]amino]-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-[[(2S,3R)-2,4-dihydroxy-3-[(1S)-1-hydroxy-2-oxoethoxy]butylidene]amino]-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10094770 |
| Molecular Formula | C17H20N4O8S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[[(2S,3R)-2,4-dihydroxy-3-[(1S)-1-hydroxy-2-oxoethoxy]butylidene]amino]-N-(5-methoxypyrimidin-2-yl)benzenesulfonamide |
| SMILES | COc1cnc(NS(=O)(=O)c2ccc(/N=C/[C@H](O)[C@@H](CO)O[C@H](O)C=O)cc2)nc1 |
| InChI | InChI=1S/C17H20N4O8S/c1-28-12-6-19-17(20-7-12)21-30(26,27)13-4-2-11(3-5-13)18-8-14(24)15(9-22)29-16(25)10-23/h2-8,10,14-16,22,24-25H,9H2,1H3,(H,19,20,21)/b18-8+/t14-,15+,16-/m0/s1 |
| InChIKey | FXJXHMLIDSEQFZ-YNILMFFMSA-N |
| XLogP | -0.76 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|