C18H15N4O4S- — CID 2228451
2-(benzenesulfonamido)-N-(3-methoxyphenyl)pyrimidine-5-carboximidate (PubChem CID 2228451) has the molecular formula C18H15N4O4S- and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-(3-methoxyphenyl)pyrimidine-5-carboximidate.
| Compound Name | 2-(benzenesulfonamido)-N-(3-methoxyphenyl)pyrimidine-5-carboximidate |
|---|---|
| PubChem CID | 2228451 |
| Molecular Formula | C18H15N4O4S- |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-(benzenesulfonamido)-N-(3-methoxyphenyl)pyrimidine-5-carboximidate |
| SMILES | COc1cccc(/N=C(\[O-])c2cnc(NS(=O)(=O)c3ccccc3)nc2)c1 |
| InChI | InChI=1S/C18H16N4O4S/c1-26-15-7-5-6-14(10-15)21-17(23)13-11-19-18(20-12-13)22-27(24,25)16-8-3-2-4-9-16/h2-12H,1H3,(H,21,23)(H,19,20,22)/p-1 |
| InChIKey | UPIMKKWYWHGCDR-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|