C14H12N2O4S — CID 110759720
N-(3-methoxyphenyl)-1,3-benzoxazole-6-sulfonamide (PubChem CID 110759720) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-(3-methoxyphenyl)-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110759720 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-(3-methoxyphenyl)-1,3-benzoxazole-6-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc3ncoc3c2)c1 |
| InChI | InChI=1S/C14H12N2O4S/c1-19-11-4-2-3-10(7-11)16-21(17,18)12-5-6-13-14(8-12)20-9-15-13/h2-9,16H,1H3 |
| InChIKey | VIYRWZSNBAWHPA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |