C16H17N3O3S — CID 110760456
N-(3-methoxyphenyl)-1,2-dimethylbenzimidazole-5-sulfonamide (PubChem CID 110760456) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1,2-dimethylbenzimidazole-5-sulfonamide.
| Compound Name | N-(3-methoxyphenyl)-1,2-dimethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760456 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(3-methoxyphenyl)-1,2-dimethylbenzimidazole-5-sulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc3c(c2)nc(C)n3C)c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-11-17-15-10-14(7-8-16(15)19(11)2)23(20,21)18-12-5-4-6-13(9-12)22-3/h4-10,18H,1-3H3 |
| InChIKey | RYRHZQIZBUCXST-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |