C18H21N3O2S — CID 110760445
1,2-dimethyl-N-(4-propan-2-ylphenyl)benzimidazole-5-sulfonamide (PubChem CID 110760445) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1,2-dimethyl-N-(4-propan-2-ylphenyl)benzimidazole-5-sulfonamide.
| Compound Name | 1,2-dimethyl-N-(4-propan-2-ylphenyl)benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760445 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1,2-dimethyl-N-(4-propan-2-ylphenyl)benzimidazole-5-sulfonamide |
| SMILES | Cc1nc2cc(S(=O)(=O)Nc3ccc(C(C)C)cc3)ccc2n1C |
| InChI | InChI=1S/C18H21N3O2S/c1-12(2)14-5-7-15(8-6-14)20-24(22,23)16-9-10-18-17(11-16)19-13(3)21(18)4/h5-12,20H,1-4H3 |
| InChIKey | VNSDDZNNGJDYOR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |