C14H15N3O3S — CID 110760391
N-(furan-2-ylmethyl)-1,2-dimethylbenzimidazole-5-sulfonamide (PubChem CID 110760391) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,2-dimethylbenzimidazole-5-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-1,2-dimethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760391 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,2-dimethylbenzimidazole-5-sulfonamide |
| SMILES | Cc1nc2cc(S(=O)(=O)NCc3ccco3)ccc2n1C |
| InChI | InChI=1S/C14H15N3O3S/c1-10-16-13-8-12(5-6-14(13)17(10)2)21(18,19)15-9-11-4-3-7-20-11/h3-8,15H,9H2,1-2H3 |
| InChIKey | WNZDIKSGGWKUIC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |