C16H16ClN3O2S — CID 110786053
3-chloro-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]benzenesulfonamide (PubChem CID 110786053) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 3-chloro-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110786053 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-chloro-N-[(1,2-dimethylbenzimidazol-5-yl)methyl]benzenesulfonamide |
| SMILES | Cc1nc2cc(CNS(=O)(=O)c3cccc(Cl)c3)ccc2n1C |
| InChI | InChI=1S/C16H16ClN3O2S/c1-11-19-15-8-12(6-7-16(15)20(11)2)10-18-23(21,22)14-5-3-4-13(17)9-14/h3-9,18H,10H2,1-2H3 |
| InChIKey | JIRRFLRUGWRZLH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |