C16H17N3O2S — CID 110760432
N,1,2-trimethyl-N-phenylbenzimidazole-5-sulfonamide (PubChem CID 110760432) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N,1,2-trimethyl-N-phenylbenzimidazole-5-sulfonamide.
| Compound Name | N,1,2-trimethyl-N-phenylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 110760432 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N,1,2-trimethyl-N-phenylbenzimidazole-5-sulfonamide |
| SMILES | Cc1nc2cc(S(=O)(=O)N(C)c3ccccc3)ccc2n1C |
| InChI | InChI=1S/C16H17N3O2S/c1-12-17-15-11-14(9-10-16(15)18(12)2)22(20,21)19(3)13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | ZTPLHKSYPGKPJS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |