C10H9ClF2N2O2S — CID 12993845
5-[chloro(difluoro)methyl]sulfonyl-1,2-dimethylbenzimidazole (PubChem CID 12993845) has the molecular formula C10H9ClF2N2O2S and a molecular weight of 294.71 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]sulfonyl-1,2-dimethylbenzimidazole.
| Compound Name | 5-[chloro(difluoro)methyl]sulfonyl-1,2-dimethylbenzimidazole |
|---|---|
| PubChem CID | 12993845 |
| Molecular Formula | C10H9ClF2N2O2S |
| Molecular Weight | 294.71 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 5-[chloro(difluoro)methyl]sulfonyl-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2cc(S(=O)(=O)C(F)(F)Cl)ccc2n1C |
| InChI | InChI=1S/C10H9ClF2N2O2S/c1-6-14-8-5-7(3-4-9(8)15(6)2)18(16,17)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | GPYJWYQTJLTBQM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.71 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|