C23H20N2O7S2 — CID 4067948
2-N,7-N-bis(furan-2-ylmethyl)-9-hydroxy-9H-fluorene-2,7-disulfonamide (PubChem CID 4067948) has the molecular formula C23H20N2O7S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-N,7-N-bis(furan-2-ylmethyl)-9-hydroxy-9H-fluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(furan-2-ylmethyl)-9-hydroxy-9H-fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 4067948 |
| Molecular Formula | C23H20N2O7S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 2-N,7-N-bis(furan-2-ylmethyl)-9-hydroxy-9H-fluorene-2,7-disulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)c1ccc2c(c1)C(O)c1cc(S(=O)(=O)NCc3ccco3)ccc1-2 |
| InChI | InChI=1S/C23H20N2O7S2/c26-23-21-11-17(33(27,28)24-13-15-3-1-9-31-15)5-7-19(21)20-8-6-18(12-22(20)23)34(29,30)25-14-16-4-2-10-32-16/h1-12,23-26H,13-14H2 |
| InChIKey | SFIUGJVDLKJRLR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |