C20H19F3N2O3S — CID 21015326
1-methyl-2-oxo-N-(4-propan-2-ylphenyl)-4-(trifluoromethyl)quinoline-6-sulfonamide (PubChem CID 21015326) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-(4-propan-2-ylphenyl)-4-(trifluoromethyl)quinoline-6-sulfonamide.
| Compound Name | 1-methyl-2-oxo-N-(4-propan-2-ylphenyl)-4-(trifluoromethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 21015326 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-methyl-2-oxo-N-(4-propan-2-ylphenyl)-4-(trifluoromethyl)quinoline-6-sulfonamide |
| SMILES | CC(C)c1ccc(NS(=O)(=O)c2ccc3c(c2)c(C(F)(F)F)cc(=O)n3C)cc1 |
| InChI | InChI=1S/C20H19F3N2O3S/c1-12(2)13-4-6-14(7-5-13)24-29(27,28)15-8-9-18-16(10-15)17(20(21,22)23)11-19(26)25(18)3/h4-12,24H,1-3H3 |
| InChIKey | QMSTZMXJQGMJJF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |