C18H12F6N2O3S — CID 21015297
1-methyl-2-oxo-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinoline-6-sulfonamide (PubChem CID 21015297) has the molecular formula C18H12F6N2O3S and a molecular weight of 450.36 g/mol. Its IUPAC name is 1-methyl-2-oxo-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinoline-6-sulfonamide.
| Compound Name | 1-methyl-2-oxo-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 21015297 |
| Molecular Formula | C18H12F6N2O3S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 1-methyl-2-oxo-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]quinoline-6-sulfonamide |
| SMILES | Cn1c(=O)cc(C(F)(F)F)c2cc(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C18H12F6N2O3S/c1-26-15-6-5-12(8-13(15)14(9-16(26)27)18(22,23)24)30(28,29)25-11-4-2-3-10(7-11)17(19,20)21/h2-9,25H,1H3 |
| InChIKey | GTNPFDRUYAZPFN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |