C24H19F3N2O3S — CID 21015304
1-methyl-N-(2-methyl-5-phenylphenyl)-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide (PubChem CID 21015304) has the molecular formula C24H19F3N2O3S and a molecular weight of 472.49 g/mol. Its IUPAC name is 1-methyl-N-(2-methyl-5-phenylphenyl)-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide.
| Compound Name | 1-methyl-N-(2-methyl-5-phenylphenyl)-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 21015304 |
| Molecular Formula | C24H19F3N2O3S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 1-methyl-N-(2-methyl-5-phenylphenyl)-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide |
| SMILES | Cc1ccc(-c2ccccc2)cc1NS(=O)(=O)c1ccc2c(c1)c(C(F)(F)F)cc(=O)n2C |
| InChI | InChI=1S/C24H19F3N2O3S/c1-15-8-9-17(16-6-4-3-5-7-16)12-21(15)28-33(31,32)18-10-11-22-19(13-18)20(24(25,26)27)14-23(30)29(22)2/h3-14,28H,1-2H3 |
| InChIKey | TXKAQGBELBLKEN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |