C21H17N3O4S — CID 177374477
1-methyl-2,4-dioxo-N-(4-phenylphenyl)quinazoline-6-sulfonamide (PubChem CID 177374477) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-N-(4-phenylphenyl)quinazoline-6-sulfonamide.
| Compound Name | 1-methyl-2,4-dioxo-N-(4-phenylphenyl)quinazoline-6-sulfonamide |
|---|---|
| PubChem CID | 177374477 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-methyl-2,4-dioxo-N-(4-phenylphenyl)quinazoline-6-sulfonamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2cc(S(=O)(=O)Nc3ccc(-c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C21H17N3O4S/c1-24-19-12-11-17(13-18(19)20(25)22-21(24)26)29(27,28)23-16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-13,23H,1H3,(H,22,25,26) |
| InChIKey | AJPKGUCYWOAPGZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |