C22H19N3O4S — CID 138634373
N-hydroxy-4-[(1-methyl-3-phenylindol-5-yl)sulfamoyl]benzamide (PubChem CID 138634373) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-hydroxy-4-[(1-methyl-3-phenylindol-5-yl)sulfamoyl]benzamide.
| Compound Name | N-hydroxy-4-[(1-methyl-3-phenylindol-5-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 138634373 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-hydroxy-4-[(1-methyl-3-phenylindol-5-yl)sulfamoyl]benzamide |
| SMILES | Cn1cc(-c2ccccc2)c2cc(NS(=O)(=O)c3ccc(C(=O)NO)cc3)ccc21 |
| InChI | InChI=1S/C22H19N3O4S/c1-25-14-20(15-5-3-2-4-6-15)19-13-17(9-12-21(19)25)24-30(28,29)18-10-7-16(8-11-18)22(26)23-27/h2-14,24,27H,1H3,(H,23,26) |
| InChIKey | KEHIACLIMHQKKL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|