C29H25N3O5S — CID 138634359
N-hydroxy-4-[[1-methyl-3-(3-phenylmethoxyphenyl)indol-5-yl]sulfamoyl]benzamide (PubChem CID 138634359) has the molecular formula C29H25N3O5S and a molecular weight of 527.60 g/mol. Its IUPAC name is N-hydroxy-4-[[1-methyl-3-(3-phenylmethoxyphenyl)indol-5-yl]sulfamoyl]benzamide.
| Compound Name | N-hydroxy-4-[[1-methyl-3-(3-phenylmethoxyphenyl)indol-5-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 138634359 |
| Molecular Formula | C29H25N3O5S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | N-hydroxy-4-[[1-methyl-3-(3-phenylmethoxyphenyl)indol-5-yl]sulfamoyl]benzamide |
| SMILES | Cn1cc(-c2cccc(OCc3ccccc3)c2)c2cc(NS(=O)(=O)c3ccc(C(=O)NO)cc3)ccc21 |
| InChI | InChI=1S/C29H25N3O5S/c1-32-18-27(22-8-5-9-24(16-22)37-19-20-6-3-2-4-7-20)26-17-23(12-15-28(26)32)31-38(35,36)25-13-10-21(11-14-25)29(33)30-34/h2-18,31,34H,19H2,1H3,(H,30,33) |
| InChIKey | IZTNWCDABNKJFV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|