C20H19F3N2O3S — CID 22238825
N-benzyl-N-ethyl-1-methyl-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide (PubChem CID 22238825) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1-methyl-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide.
| Compound Name | N-benzyl-N-ethyl-1-methyl-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 22238825 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-benzyl-N-ethyl-1-methyl-2-oxo-4-(trifluoromethyl)quinoline-6-sulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc2c(c1)c(C(F)(F)F)cc(=O)n2C |
| InChI | InChI=1S/C20H19F3N2O3S/c1-3-25(13-14-7-5-4-6-8-14)29(27,28)15-9-10-18-16(11-15)17(20(21,22)23)12-19(26)24(18)2/h4-12H,3,13H2,1-2H3 |
| InChIKey | CQZCYKXSELPQIA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |