C16H21FN2O2S — CID 142925669
6-[[ethyl(propyl)amino]-methylidene-oxo-λ6-sulfanyl]-4-fluoro-1-methylquinolin-2-one (PubChem CID 142925669) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is 6-[[ethyl(propyl)amino]-methylidene-oxo-λ6-sulfanyl]-4-fluoro-1-methylquinolin-2-one.
| Compound Name | 6-[[ethyl(propyl)amino]-methylidene-oxo-λ6-sulfanyl]-4-fluoro-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 142925669 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 6-[[ethyl(propyl)amino]-methylidene-oxo-λ6-sulfanyl]-4-fluoro-1-methylquinolin-2-one |
| SMILES | C=S(=O)(c1ccc2c(c1)c(F)cc(=O)n2C)N(CC)CCC |
| InChI | InChI=1S/C16H21FN2O2S/c1-5-9-19(6-2)22(4,21)12-7-8-15-13(10-12)14(17)11-16(20)18(15)3/h7-8,10-11H,4-6,9H2,1-3H3 |
| InChIKey | LWHPKGIXIASWOB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|