C20H18BrFN2O2 — CID 55761321
N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 55761321) has the molecular formula C20H18BrFN2O2 and a molecular weight of 417.28 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55761321 |
| Molecular Formula | C20H18BrFN2O2 |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | CCN(Cc1cc(Br)ccc1F)C(=O)c1cc(=O)n(C)c2ccccc12 |
| InChI | InChI=1S/C20H18BrFN2O2/c1-3-24(12-13-10-14(21)8-9-17(13)22)20(26)16-11-19(25)23(2)18-7-5-4-6-15(16)18/h4-11H,3,12H2,1-2H3 |
| InChIKey | IOIXPOXXFMIKMQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |