C14H13BrFN3O2 — CID 86926377
N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 86926377) has the molecular formula C14H13BrFN3O2 and a molecular weight of 354.18 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 86926377 |
| Molecular Formula | C14H13BrFN3O2 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCN(Cc1cc(Br)ccc1F)C(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C14H13BrFN3O2/c1-2-19(8-9-7-10(15)3-4-11(9)16)14(21)12-5-6-13(20)18-17-12/h3-7H,2,8H2,1H3,(H,18,20) |
| InChIKey | OCRHRKOVVOJYMP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |