C17H15F3N4O4S2 — CID 166206509
1-methyl-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]imidazole-4-sulfonamide (PubChem CID 166206509) has the molecular formula C17H15F3N4O4S2 and a molecular weight of 460.46 g/mol. Its IUPAC name is 1-methyl-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]imidazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 166206509 |
| Molecular Formula | C17H15F3N4O4S2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 1-methyl-N-[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C17H15F3N4O4S2/c1-24-10-16(21-11-24)30(27,28)23-14-6-3-7-15(9-14)29(25,26)22-13-5-2-4-12(8-13)17(18,19)20/h2-11,22-23H,1H3 |
| InChIKey | NIAIRKZHIKBQOP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |