C13H14ClN5O2S — CID 169368104
2-chloro-N'-[4-[(5-methylpyrimidin-2-yl)sulfamoyl]phenyl]ethanimidamide (PubChem CID 169368104) has the molecular formula C13H14ClN5O2S and a molecular weight of 339.81 g/mol. Its IUPAC name is 2-chloro-N'-[4-[(5-methylpyrimidin-2-yl)sulfamoyl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[(5-methylpyrimidin-2-yl)sulfamoyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368104 |
| Molecular Formula | C13H14ClN5O2S |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-chloro-N'-[4-[(5-methylpyrimidin-2-yl)sulfamoyl]phenyl]ethanimidamide |
| SMILES | Cc1cnc(NS(=O)(=O)c2ccc(/N=C(/N)CCl)cc2)nc1 |
| InChI | InChI=1S/C13H14ClN5O2S/c1-9-7-16-13(17-8-9)19-22(20,21)11-4-2-10(3-5-11)18-12(15)6-14/h2-5,7-8H,6H2,1H3,(H2,15,18)(H,16,17,19) |
| InChIKey | BXZQQFSBFJQGNY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|