C11H16ClN3 — CID 169369257
2-chloro-N'-[4-[2-(methylamino)ethyl]phenyl]ethanimidamide (PubChem CID 169369257) has the molecular formula C11H16ClN3 and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-chloro-N'-[4-[2-(methylamino)ethyl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-[2-(methylamino)ethyl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169369257 |
| Molecular Formula | C11H16ClN3 |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-chloro-N'-[4-[2-(methylamino)ethyl]phenyl]ethanimidamide |
| SMILES | CNCCc1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C11H16ClN3/c1-14-7-6-9-2-4-10(5-3-9)15-11(13)8-12/h2-5,14H,6-8H2,1H3,(H2,13,15) |
| InChIKey | FHCZKSLUBTVYSI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|