C13H21ClN3O+ — CID 169369058
2-[4-[(1-amino-2-chloroethylidene)amino]phenoxy]ethyl-trimethylazanium (PubChem CID 169369058) has the molecular formula C13H21ClN3O+ and a molecular weight of 270.78 g/mol. Its IUPAC name is 2-[4-[(1-amino-2-chloroethylidene)amino]phenoxy]ethyl-trimethylazanium.
| Compound Name | 2-[4-[(1-amino-2-chloroethylidene)amino]phenoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 169369058 |
| Molecular Formula | C13H21ClN3O+ |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[4-[(1-amino-2-chloroethylidene)amino]phenoxy]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOc1ccc(/N=C(/N)CCl)cc1 |
| InChI | InChI=1S/C13H21ClN3O/c1-17(2,3)8-9-18-12-6-4-11(5-7-12)16-13(15)10-14/h4-7H,8-10H2,1-3H3,(H2,15,16)/q+1 |
| InChIKey | IAXVTTZBRGNVGV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|